C15H16N6 — CID 43195693
N-(pyridin-2-ylmethyl)-1-[3-(tetrazol-1-yl)phenyl]ethanamine (PubChem CID 43195693) has the molecular formula C15H16N6 and a molecular weight of 280.33 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)-1-[3-(tetrazol-1-yl)phenyl]ethanamine.
| Compound Name | N-(pyridin-2-ylmethyl)-1-[3-(tetrazol-1-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 43195693 |
| Molecular Formula | C15H16N6 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | N-(pyridin-2-ylmethyl)-1-[3-(tetrazol-1-yl)phenyl]ethanamine |
| SMILES | CC(NCc1ccccn1)c1cccc(-n2cnnn2)c1 |
| InChI | InChI=1S/C15H16N6/c1-12(17-10-14-6-2-3-8-16-14)13-5-4-7-15(9-13)21-11-18-19-20-21/h2-9,11-12,17H,10H2,1H3 |
| InChIKey | UKQATPCDRDNPDC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |