C14H14BrN3O — CID 116643795
N-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]pent-3-yn-1-amine (PubChem CID 116643795) has the molecular formula C14H14BrN3O and a molecular weight of 320.19 g/mol. Its IUPAC name is N-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]pent-3-yn-1-amine.
| Compound Name | N-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]pent-3-yn-1-amine |
|---|---|
| PubChem CID | 116643795 |
| Molecular Formula | C14H14BrN3O |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | N-[[5-(2-bromophenyl)-1,3,4-oxadiazol-2-yl]methyl]pent-3-yn-1-amine |
| SMILES | CC#CCCNCc1nnc(-c2ccccc2Br)o1 |
| InChI | InChI=1S/C14H14BrN3O/c1-2-3-6-9-16-10-13-17-18-14(19-13)11-7-4-5-8-12(11)15/h4-5,7-8,16H,6,9-10H2,1H3 |
| InChIKey | ZQRZJMDRTDIMNA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|