About methyl 2-quinolin-2-ylhexanoate
methyl 2-quinolin-2-ylhexanoate (PubChem CID 116645151) has the molecular formula C16H19NO2
and a molecular weight of 257.33 g/mol. Its IUPAC name is methyl 2-quinolin-2-ylhexanoate.
Molecular Properties
| Compound Name | methyl 2-quinolin-2-ylhexanoate |
| PubChem CID | 116645151 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | methyl 2-quinolin-2-ylhexanoate |
| SMILES | CCCCC(C(=O)OC)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C16H19NO2/c1-3-4-8-13(16(18)19-2)15-11-10-12-7-5-6-9-14(12)17-15/h5-7,9-11,13H,3-4,8H2,1-2H3 |
| InChIKey | QBHWNIVWZGTLCL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-quinolin-2-ylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-quinolin-2-ylhexanoate?
The IUPAC name of methyl 2-quinolin-2-ylhexanoate (CID 116645151) is methyl 2-quinolin-2-ylhexanoate.
What is the SMILES notation for methyl 2-quinolin-2-ylhexanoate?
The canonical SMILES for methyl 2-quinolin-2-ylhexanoate is CCCCC(C(=O)OC)c1ccc2ccccc2n1.
What is the InChIKey of methyl 2-quinolin-2-ylhexanoate?
The InChIKey is QBHWNIVWZGTLCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO2/c1-3-4-8-13(16(18)19-2)15-11-10-12-7-5-6-9-14(12)17-15/h5-7,9-11,13H,3-4,8H2,1-2H3.
What are the key properties of methyl 2-quinolin-2-ylhexanoate?
methyl 2-quinolin-2-ylhexanoate has a molecular weight of 257.33 g/mol, XLogP of 3.68, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-quinolin-2-ylhexanoate is sourced from PubChem (CID 116645151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).