C13H17N3 — CID 171236567
(1S)-1-quinolin-2-ylbutane-1,4-diamine (PubChem CID 171236567) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is (1S)-1-quinolin-2-ylbutane-1,4-diamine.
| Compound Name | (1S)-1-quinolin-2-ylbutane-1,4-diamine |
|---|---|
| PubChem CID | 171236567 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | (1S)-1-quinolin-2-ylbutane-1,4-diamine |
| SMILES | NCCC[C@H](N)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C13H17N3/c14-9-3-5-11(15)13-8-7-10-4-1-2-6-12(10)16-13/h1-2,4,6-8,11H,3,5,9,14-15H2/t11-/m0/s1 |
| InChIKey | CPOBYZCPHHONKW-NSHDSACASA-N |
| XLogP | 1.97 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |