C12H12F2N2 — CID 171314038
(1R)-3,3-difluoro-1-quinolin-2-ylpropan-1-amine (PubChem CID 171314038) has the molecular formula C12H12F2N2 and a molecular weight of 222.24 g/mol. Its IUPAC name is (1R)-3,3-difluoro-1-quinolin-2-ylpropan-1-amine.
| Compound Name | (1R)-3,3-difluoro-1-quinolin-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 171314038 |
| Molecular Formula | C12H12F2N2 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (1R)-3,3-difluoro-1-quinolin-2-ylpropan-1-amine |
| SMILES | N[C@H](CC(F)F)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C12H12F2N2/c13-12(14)7-9(15)11-6-5-8-3-1-2-4-10(8)16-11/h1-6,9,12H,7,15H2/t9-/m1/s1 |
| InChIKey | KAUPLVOMFWDWSV-SECBINFHSA-N |
| XLogP | 2.89 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |