C13H11N5O — CID 116645315
4-methoxy-6-quinolin-2-yl-1,3,5-triazin-2-amine (PubChem CID 116645315) has the molecular formula C13H11N5O and a molecular weight of 253.27 g/mol. Its IUPAC name is 4-methoxy-6-quinolin-2-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-methoxy-6-quinolin-2-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 116645315 |
| Molecular Formula | C13H11N5O |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 4-methoxy-6-quinolin-2-yl-1,3,5-triazin-2-amine |
| SMILES | COc1nc(N)nc(-c2ccc3ccccc3n2)n1 |
| InChI | InChI=1S/C13H11N5O/c1-19-13-17-11(16-12(14)18-13)10-7-6-8-4-2-3-5-9(8)15-10/h2-7H,1H3,(H2,14,16,17,18) |
| InChIKey | BOMKCJILZOZALH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 86.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |