C7H9BrN4O2S — CID 116646272
2-(3-amino-4-bromophenyl)sulfonylguanidine (PubChem CID 116646272) has the molecular formula C7H9BrN4O2S and a molecular weight of 293.15 g/mol. Its IUPAC name is 2-(3-amino-4-bromophenyl)sulfonylguanidine.
| Compound Name | 2-(3-amino-4-bromophenyl)sulfonylguanidine |
|---|---|
| PubChem CID | 116646272 |
| Molecular Formula | C7H9BrN4O2S |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 291.96 |
| IUPAC Name | 2-(3-amino-4-bromophenyl)sulfonylguanidine |
| SMILES | NC(N)=NS(=O)(=O)c1ccc(Br)c(N)c1 |
| InChI | InChI=1S/C7H9BrN4O2S/c8-5-2-1-4(3-6(5)9)15(13,14)12-7(10)11/h1-3H,9H2,(H4,10,11,12) |
| InChIKey | PKEOFCREVQUAAW-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|