C5H10N6O2S — CID 116646299
2-(3-amino-1-methylpyrazol-4-yl)sulfonylguanidine (PubChem CID 116646299) has the molecular formula C5H10N6O2S and a molecular weight of 218.24 g/mol. Its IUPAC name is 2-(3-amino-1-methylpyrazol-4-yl)sulfonylguanidine.
| Compound Name | 2-(3-amino-1-methylpyrazol-4-yl)sulfonylguanidine |
|---|---|
| PubChem CID | 116646299 |
| Molecular Formula | C5H10N6O2S |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 2-(3-amino-1-methylpyrazol-4-yl)sulfonylguanidine |
| SMILES | Cn1cc(S(=O)(=O)N=C(N)N)c(N)n1 |
| InChI | InChI=1S/C5H10N6O2S/c1-11-2-3(4(6)9-11)14(12,13)10-5(7)8/h2H,1H3,(H2,6,9)(H4,7,8,10) |
| InChIKey | MZZHUXLVYJIZRK-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 142.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|