C9H13IN4 — CID 116649643
N-[(3-aminocyclobutyl)methyl]-5-iodopyrimidin-2-amine (PubChem CID 116649643) has the molecular formula C9H13IN4 and a molecular weight of 304.14 g/mol. Its IUPAC name is N-[(3-aminocyclobutyl)methyl]-5-iodopyrimidin-2-amine.
| Compound Name | N-[(3-aminocyclobutyl)methyl]-5-iodopyrimidin-2-amine |
|---|---|
| PubChem CID | 116649643 |
| Molecular Formula | C9H13IN4 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | N-[(3-aminocyclobutyl)methyl]-5-iodopyrimidin-2-amine |
| SMILES | NC1CC(CNc2ncc(I)cn2)C1 |
| InChI | InChI=1S/C9H13IN4/c10-7-4-13-9(14-5-7)12-3-6-1-8(11)2-6/h4-6,8H,1-3,11H2,(H,12,13,14) |
| InChIKey | RCRUFKCIICBGFJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|