C8H11ClN4 — CID 116650934
(E)-N'-(6-chloropyrazin-2-yl)but-2-ene-1,4-diamine (PubChem CID 116650934) has the molecular formula C8H11ClN4 and a molecular weight of 198.66 g/mol. Its IUPAC name is (E)-N'-(6-chloropyrazin-2-yl)but-2-ene-1,4-diamine.
| Compound Name | (E)-N'-(6-chloropyrazin-2-yl)but-2-ene-1,4-diamine |
|---|---|
| PubChem CID | 116650934 |
| Molecular Formula | C8H11ClN4 |
| Molecular Weight | 198.66 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | (E)-N'-(6-chloropyrazin-2-yl)but-2-ene-1,4-diamine |
| SMILES | NC/C=C/CNc1cncc(Cl)n1 |
| InChI | InChI=1S/C8H11ClN4/c9-7-5-11-6-8(13-7)12-4-2-1-3-10/h1-2,5-6H,3-4,10H2,(H,12,13)/b2-1+ |
| InChIKey | XGIWTDCWKGVSES-OWOJBTEDSA-N |
| XLogP | 1.06 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.66 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|