C17H22ClNO — CID 116650978
1-(6-chloro-1-methylindol-3-yl)-3,4,4-trimethylpentan-1-one (PubChem CID 116650978) has the molecular formula C17H22ClNO and a molecular weight of 291.82 g/mol. Its IUPAC name is 1-(6-chloro-1-methylindol-3-yl)-3,4,4-trimethylpentan-1-one.
| Compound Name | 1-(6-chloro-1-methylindol-3-yl)-3,4,4-trimethylpentan-1-one |
|---|---|
| PubChem CID | 116650978 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 1-(6-chloro-1-methylindol-3-yl)-3,4,4-trimethylpentan-1-one |
| SMILES | CC(CC(=O)c1cn(C)c2cc(Cl)ccc12)C(C)(C)C |
| InChI | InChI=1S/C17H22ClNO/c1-11(17(2,3)4)8-16(20)14-10-19(5)15-9-12(18)6-7-13(14)15/h6-7,9-11H,8H2,1-5H3 |
| InChIKey | IEQBHOMTTAHPSH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |