C12H17Cl2N3 — CID 116652443
1-cyclopropyl-N-[(3,6-dichloro-2-pyridinyl)methyl]-N-methylethane-1,2-diamine (PubChem CID 116652443) has the molecular formula C12H17Cl2N3 and a molecular weight of 274.19 g/mol. Its IUPAC name is 1-cyclopropyl-N-[(3,6-dichloro-2-pyridinyl)methyl]-N-methylethane-1,2-diamine.
| Compound Name | 1-cyclopropyl-N-[(3,6-dichloro-2-pyridinyl)methyl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 116652443 |
| Molecular Formula | C12H17Cl2N3 |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 1-cyclopropyl-N-[(3,6-dichloro-2-pyridinyl)methyl]-N-methylethane-1,2-diamine |
| SMILES | CN(Cc1nc(Cl)ccc1Cl)C(CN)C1CC1 |
| InChI | InChI=1S/C12H17Cl2N3/c1-17(11(6-15)8-2-3-8)7-10-9(13)4-5-12(14)16-10/h4-5,8,11H,2-3,6-7,15H2,1H3 |
| InChIKey | PRAIYNABMIDRIJ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|