C11H20N2 — CID 116652552
1-cyclopropyl-N-methyl-N-pent-3-ynylethane-1,2-diamine (PubChem CID 116652552) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 1-cyclopropyl-N-methyl-N-pent-3-ynylethane-1,2-diamine.
| Compound Name | 1-cyclopropyl-N-methyl-N-pent-3-ynylethane-1,2-diamine |
|---|---|
| PubChem CID | 116652552 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1-cyclopropyl-N-methyl-N-pent-3-ynylethane-1,2-diamine |
| SMILES | CC#CCCN(C)C(CN)C1CC1 |
| InChI | InChI=1S/C11H20N2/c1-3-4-5-8-13(2)11(9-12)10-6-7-10/h10-11H,5-9,12H2,1-2H3 |
| InChIKey | CXZNAPRSDNZWIG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|