C13H26N2O — CID 116654337
N,3-dimethyl-N-pentan-2-ylpiperidine-1-carboxamide (PubChem CID 116654337) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is N,3-dimethyl-N-pentan-2-ylpiperidine-1-carboxamide.
| Compound Name | N,3-dimethyl-N-pentan-2-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 116654337 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | N,3-dimethyl-N-pentan-2-ylpiperidine-1-carboxamide |
| SMILES | CCCC(C)N(C)C(=O)N1CCCC(C)C1 |
| InChI | InChI=1S/C13H26N2O/c1-5-7-12(3)14(4)13(16)15-9-6-8-11(2)10-15/h11-12H,5-10H2,1-4H3 |
| InChIKey | YSNXIDXNTTZLQS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |