C17H32N2O2 — CID 10286267
(2S,3R)-5-methyl-3-(3-methylpiperidine-1-carbonyl)-2-propylhexanamide (PubChem CID 10286267) has the molecular formula C17H32N2O2 and a molecular weight of 296.45 g/mol. Its IUPAC name is (2S,3R)-5-methyl-3-(3-methylpiperidine-1-carbonyl)-2-propylhexanamide.
| Compound Name | (2S,3R)-5-methyl-3-(3-methylpiperidine-1-carbonyl)-2-propylhexanamide |
|---|---|
| PubChem CID | 10286267 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | (2S,3R)-5-methyl-3-(3-methylpiperidine-1-carbonyl)-2-propylhexanamide |
| SMILES | CCC[C@H](C(N)=O)[C@@H](CC(C)C)C(=O)N1CCCC(C)C1 |
| InChI | InChI=1S/C17H32N2O2/c1-5-7-14(16(18)20)15(10-12(2)3)17(21)19-9-6-8-13(4)11-19/h12-15H,5-11H2,1-4H3,(H2,18,20)/t13?,14-,15+/m0/s1 |
| InChIKey | TXGXEZNGNBDAED-NOYMGPGASA-N |
| XLogP | 2.81 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |