C22H35N3O2 — CID 10126351
(2S,3R)-5-methyl-3-(3-methyl-4-phenylpiperazine-1-carbonyl)-2-propylhexanamide (PubChem CID 10126351) has the molecular formula C22H35N3O2 and a molecular weight of 373.54 g/mol. Its IUPAC name is (2S,3R)-5-methyl-3-(3-methyl-4-phenylpiperazine-1-carbonyl)-2-propylhexanamide.
| Compound Name | (2S,3R)-5-methyl-3-(3-methyl-4-phenylpiperazine-1-carbonyl)-2-propylhexanamide |
|---|---|
| PubChem CID | 10126351 |
| Molecular Formula | C22H35N3O2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.27 |
| IUPAC Name | (2S,3R)-5-methyl-3-(3-methyl-4-phenylpiperazine-1-carbonyl)-2-propylhexanamide |
| SMILES | CCC[C@H](C(N)=O)[C@@H](CC(C)C)C(=O)N1CCN(c2ccccc2)C(C)C1 |
| InChI | InChI=1S/C22H35N3O2/c1-5-9-19(21(23)26)20(14-16(2)3)22(27)24-12-13-25(17(4)15-24)18-10-7-6-8-11-18/h6-8,10-11,16-17,19-20H,5,9,12-15H2,1-4H3,(H2,23,26)/t17?,19-,20+/m0/s1 |
| InChIKey | FAPUSHAPHQQFGF-ZYJPSCNZSA-N |
| XLogP | 3.29 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |