C16H32N2O — CID 116656850
N-(2,2-dimethylheptyl)-3-methylpiperidine-1-carboxamide (PubChem CID 116656850) has the molecular formula C16H32N2O and a molecular weight of 268.44 g/mol. Its IUPAC name is N-(2,2-dimethylheptyl)-3-methylpiperidine-1-carboxamide.
| Compound Name | N-(2,2-dimethylheptyl)-3-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 116656850 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | N-(2,2-dimethylheptyl)-3-methylpiperidine-1-carboxamide |
| SMILES | CCCCCC(C)(C)CNC(=O)N1CCCC(C)C1 |
| InChI | InChI=1S/C16H32N2O/c1-5-6-7-10-16(3,4)13-17-15(19)18-11-8-9-14(2)12-18/h14H,5-13H2,1-4H3,(H,17,19) |
| InChIKey | FDNVUCGPYGVMQV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|