C10H13BrN2O — CID 116659405
1-(4-bromo-1,3-dimethylpyrazol-5-yl)pent-4-en-2-one (PubChem CID 116659405) has the molecular formula C10H13BrN2O and a molecular weight of 257.13 g/mol. Its IUPAC name is 1-(4-bromo-1,3-dimethylpyrazol-5-yl)pent-4-en-2-one.
| Compound Name | 1-(4-bromo-1,3-dimethylpyrazol-5-yl)pent-4-en-2-one |
|---|---|
| PubChem CID | 116659405 |
| Molecular Formula | C10H13BrN2O |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 1-(4-bromo-1,3-dimethylpyrazol-5-yl)pent-4-en-2-one |
| SMILES | C=CCC(=O)Cc1c(Br)c(C)nn1C |
| InChI | InChI=1S/C10H13BrN2O/c1-4-5-8(14)6-9-10(11)7(2)12-13(9)3/h4H,1,5-6H2,2-3H3 |
| InChIKey | SIYLVKDOOZUJOV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|