About 1-(1,5-dimethylpyrazol-3-yl)-1,1-difluoropropan-2-one
1-(1,5-dimethylpyrazol-3-yl)-1,1-difluoropropan-2-one (PubChem CID 123820843) has the molecular formula C8H10F2N2O
and a molecular weight of 188.18 g/mol. Its IUPAC name is 1-(1,5-dimethylpyrazol-3-yl)-1,1-difluoropropan-2-one.
Analyze 1-(1,5-dimethylpyrazol-3-yl)-1,1-difluoropropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,5-dimethylpyrazol-3-yl)-1,1-difluoropropan-2-one?
The IUPAC name of 1-(1,5-dimethylpyrazol-3-yl)-1,1-difluoropropan-2-one (CID 123820843) is 1-(1,5-dimethylpyrazol-3-yl)-1,1-difluoropropan-2-one.
What is the SMILES notation for 1-(1,5-dimethylpyrazol-3-yl)-1,1-difluoropropan-2-one?
The canonical SMILES for 1-(1,5-dimethylpyrazol-3-yl)-1,1-difluoropropan-2-one is CC(=O)C(F)(F)c1cc(C)n(C)n1.
What is the InChIKey of 1-(1,5-dimethylpyrazol-3-yl)-1,1-difluoropropan-2-one?
The InChIKey is QKTZCQBDKJVDEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2N2O/c1-5-4-7(11-12(5)3)8(9,10)6(2)13/h4H,1-3H3.
What are the key properties of 1-(1,5-dimethylpyrazol-3-yl)-1,1-difluoropropan-2-one?
1-(1,5-dimethylpyrazol-3-yl)-1,1-difluoropropan-2-one has a molecular weight of 188.18 g/mol, XLogP of 1.41, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,5-dimethylpyrazol-3-yl)-1,1-difluoropropan-2-one is sourced from PubChem (CID 123820843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).