C14H20N2O — CID 116659644
1-(cyclohexen-1-yl)-3-(2,5-dimethylpyrazol-3-yl)propan-2-one (PubChem CID 116659644) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-3-(2,5-dimethylpyrazol-3-yl)propan-2-one.
| Compound Name | 1-(cyclohexen-1-yl)-3-(2,5-dimethylpyrazol-3-yl)propan-2-one |
|---|---|
| PubChem CID | 116659644 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-(cyclohexen-1-yl)-3-(2,5-dimethylpyrazol-3-yl)propan-2-one |
| SMILES | Cc1cc(CC(=O)CC2=CCCCC2)n(C)n1 |
| InChI | InChI=1S/C14H20N2O/c1-11-8-13(16(2)15-11)10-14(17)9-12-6-4-3-5-7-12/h6,8H,3-5,7,9-10H2,1-2H3 |
| InChIKey | JDLCMGTTYSQKEG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|