C10H15ClN2O — CID 66044438
5-chloro-1-(2,5-dimethylpyrazol-3-yl)pentan-2-one (PubChem CID 66044438) has the molecular formula C10H15ClN2O and a molecular weight of 214.70 g/mol. Its IUPAC name is 5-chloro-1-(2,5-dimethylpyrazol-3-yl)pentan-2-one.
| Compound Name | 5-chloro-1-(2,5-dimethylpyrazol-3-yl)pentan-2-one |
|---|---|
| PubChem CID | 66044438 |
| Molecular Formula | C10H15ClN2O |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 5-chloro-1-(2,5-dimethylpyrazol-3-yl)pentan-2-one |
| SMILES | Cc1cc(CC(=O)CCCCl)n(C)n1 |
| InChI | InChI=1S/C10H15ClN2O/c1-8-6-9(13(2)12-8)7-10(14)4-3-5-11/h6H,3-5,7H2,1-2H3 |
| InChIKey | JNHNPLKNLREHSG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|