C18H18N2O — CID 105108407
1-(2,5-dimethylpyrazol-3-yl)-3-naphthalen-1-ylpropan-2-one (PubChem CID 105108407) has the molecular formula C18H18N2O and a molecular weight of 278.36 g/mol. Its IUPAC name is 1-(2,5-dimethylpyrazol-3-yl)-3-naphthalen-1-ylpropan-2-one.
| Compound Name | 1-(2,5-dimethylpyrazol-3-yl)-3-naphthalen-1-ylpropan-2-one |
|---|---|
| PubChem CID | 105108407 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 1-(2,5-dimethylpyrazol-3-yl)-3-naphthalen-1-ylpropan-2-one |
| SMILES | Cc1cc(CC(=O)Cc2cccc3ccccc23)n(C)n1 |
| InChI | InChI=1S/C18H18N2O/c1-13-10-16(20(2)19-13)12-17(21)11-15-8-5-7-14-6-3-4-9-18(14)15/h3-10H,11-12H2,1-2H3 |
| InChIKey | KMIQJLSSTANIFX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |