C12H20N2O — CID 116659983
1-(1-butan-2-ylpyrazol-3-yl)pent-4-en-2-ol (PubChem CID 116659983) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-(1-butan-2-ylpyrazol-3-yl)pent-4-en-2-ol.
| Compound Name | 1-(1-butan-2-ylpyrazol-3-yl)pent-4-en-2-ol |
|---|---|
| PubChem CID | 116659983 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-(1-butan-2-ylpyrazol-3-yl)pent-4-en-2-ol |
| SMILES | C=CCC(O)Cc1ccn(C(C)CC)n1 |
| InChI | InChI=1S/C12H20N2O/c1-4-6-12(15)9-11-7-8-14(13-11)10(3)5-2/h4,7-8,10,12,15H,1,5-6,9H2,2-3H3 |
| InChIKey | HBOXFXQRTVWSPP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|