C13H19NOS — CID 116660126
1-(cyclohexen-1-yl)-3-(4-methyl-1,3-thiazol-2-yl)propan-2-ol (PubChem CID 116660126) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-3-(4-methyl-1,3-thiazol-2-yl)propan-2-ol.
| Compound Name | 1-(cyclohexen-1-yl)-3-(4-methyl-1,3-thiazol-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 116660126 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 1-(cyclohexen-1-yl)-3-(4-methyl-1,3-thiazol-2-yl)propan-2-ol |
| SMILES | Cc1csc(CC(O)CC2=CCCCC2)n1 |
| InChI | InChI=1S/C13H19NOS/c1-10-9-16-13(14-10)8-12(15)7-11-5-3-2-4-6-11/h5,9,12,15H,2-4,6-8H2,1H3 |
| InChIKey | GKDXZOFIUDNVKP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|