C16H25BrN2O — CID 116660165
1-(4-bromo-1,3-diethylpyrazol-5-yl)-3-(cyclohexen-1-yl)propan-2-ol (PubChem CID 116660165) has the molecular formula C16H25BrN2O and a molecular weight of 341.29 g/mol. Its IUPAC name is 1-(4-bromo-1,3-diethylpyrazol-5-yl)-3-(cyclohexen-1-yl)propan-2-ol.
| Compound Name | 1-(4-bromo-1,3-diethylpyrazol-5-yl)-3-(cyclohexen-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 116660165 |
| Molecular Formula | C16H25BrN2O |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 1-(4-bromo-1,3-diethylpyrazol-5-yl)-3-(cyclohexen-1-yl)propan-2-ol |
| SMILES | CCc1nn(CC)c(CC(O)CC2=CCCCC2)c1Br |
| InChI | InChI=1S/C16H25BrN2O/c1-3-14-16(17)15(19(4-2)18-14)11-13(20)10-12-8-6-5-7-9-12/h8,13,20H,3-7,9-11H2,1-2H3 |
| InChIKey | KUYLZXQZSLZRFU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|