C14H19N — CID 116660529
N-methyl-1-(2-phenylcyclopropyl)but-3-en-1-amine (PubChem CID 116660529) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is N-methyl-1-(2-phenylcyclopropyl)but-3-en-1-amine.
| Compound Name | N-methyl-1-(2-phenylcyclopropyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 116660529 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | N-methyl-1-(2-phenylcyclopropyl)but-3-en-1-amine |
| SMILES | C=CCC(NC)C1CC1c1ccccc1 |
| InChI | InChI=1S/C14H19N/c1-3-7-14(15-2)13-10-12(13)11-8-5-4-6-9-11/h3-6,8-9,12-15H,1,7,10H2,2H3 |
| InChIKey | YENNJCYPVIEEMW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|