C16H18BrNS — CID 115848042
2-(4-bromothiophen-2-yl)-N-methyl-1-(2-phenylcyclopropyl)ethanamine (PubChem CID 115848042) has the molecular formula C16H18BrNS and a molecular weight of 336.30 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-N-methyl-1-(2-phenylcyclopropyl)ethanamine.
| Compound Name | 2-(4-bromothiophen-2-yl)-N-methyl-1-(2-phenylcyclopropyl)ethanamine |
|---|---|
| PubChem CID | 115848042 |
| Molecular Formula | C16H18BrNS |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-N-methyl-1-(2-phenylcyclopropyl)ethanamine |
| SMILES | CNC(Cc1cc(Br)cs1)C1CC1c1ccccc1 |
| InChI | InChI=1S/C16H18BrNS/c1-18-16(8-13-7-12(17)10-19-13)15-9-14(15)11-5-3-2-4-6-11/h2-7,10,14-16,18H,8-9H2,1H3 |
| InChIKey | NNZUYWOMZZRBCG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |