C15H16BrNS — CID 105189078
1-(5-bromothiophen-3-yl)-N-methyl-1-(2-phenylcyclopropyl)methanamine (PubChem CID 105189078) has the molecular formula C15H16BrNS and a molecular weight of 322.27 g/mol. Its IUPAC name is 1-(5-bromothiophen-3-yl)-N-methyl-1-(2-phenylcyclopropyl)methanamine.
| Compound Name | 1-(5-bromothiophen-3-yl)-N-methyl-1-(2-phenylcyclopropyl)methanamine |
|---|---|
| PubChem CID | 105189078 |
| Molecular Formula | C15H16BrNS |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 1-(5-bromothiophen-3-yl)-N-methyl-1-(2-phenylcyclopropyl)methanamine |
| SMILES | CNC(c1csc(Br)c1)C1CC1c1ccccc1 |
| InChI | InChI=1S/C15H16BrNS/c1-17-15(11-7-14(16)18-9-11)13-8-12(13)10-5-3-2-4-6-10/h2-7,9,12-13,15,17H,8H2,1H3 |
| InChIKey | VTRKJOXAANSJAR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |