C16H18INS — CID 105052605
N-[(5-iodothiophen-3-yl)-(2-phenylcyclopropyl)methyl]ethanamine (PubChem CID 105052605) has the molecular formula C16H18INS and a molecular weight of 383.30 g/mol. Its IUPAC name is N-[(5-iodothiophen-3-yl)-(2-phenylcyclopropyl)methyl]ethanamine.
| Compound Name | N-[(5-iodothiophen-3-yl)-(2-phenylcyclopropyl)methyl]ethanamine |
|---|---|
| PubChem CID | 105052605 |
| Molecular Formula | C16H18INS |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | N-[(5-iodothiophen-3-yl)-(2-phenylcyclopropyl)methyl]ethanamine |
| SMILES | CCNC(c1csc(I)c1)C1CC1c1ccccc1 |
| InChI | InChI=1S/C16H18INS/c1-2-18-16(12-8-15(17)19-10-12)14-9-13(14)11-6-4-3-5-7-11/h3-8,10,13-14,16,18H,2,9H2,1H3 |
| InChIKey | SPVPUZXIAAWCER-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|