C15H24INS — CID 104989415
N-[(3,4-dimethylcyclohexyl)-(5-iodothiophen-3-yl)methyl]ethanamine (PubChem CID 104989415) has the molecular formula C15H24INS and a molecular weight of 377.34 g/mol. Its IUPAC name is N-[(3,4-dimethylcyclohexyl)-(5-iodothiophen-3-yl)methyl]ethanamine.
| Compound Name | N-[(3,4-dimethylcyclohexyl)-(5-iodothiophen-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 104989415 |
| Molecular Formula | C15H24INS |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | N-[(3,4-dimethylcyclohexyl)-(5-iodothiophen-3-yl)methyl]ethanamine |
| SMILES | CCNC(c1csc(I)c1)C1CCC(C)C(C)C1 |
| InChI | InChI=1S/C15H24INS/c1-4-17-15(13-8-14(16)18-9-13)12-6-5-10(2)11(3)7-12/h8-12,15,17H,4-7H2,1-3H3 |
| InChIKey | MBMDKOFHKIFZMI-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|