C14H22INS — CID 104988711
1-(3,5-dimethylcyclohexyl)-1-(5-iodothiophen-3-yl)-N-methylmethanamine (PubChem CID 104988711) has the molecular formula C14H22INS and a molecular weight of 363.31 g/mol. Its IUPAC name is 1-(3,5-dimethylcyclohexyl)-1-(5-iodothiophen-3-yl)-N-methylmethanamine.
| Compound Name | 1-(3,5-dimethylcyclohexyl)-1-(5-iodothiophen-3-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 104988711 |
| Molecular Formula | C14H22INS |
| Molecular Weight | 363.31 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 1-(3,5-dimethylcyclohexyl)-1-(5-iodothiophen-3-yl)-N-methylmethanamine |
| SMILES | CNC(c1csc(I)c1)C1CC(C)CC(C)C1 |
| InChI | InChI=1S/C14H22INS/c1-9-4-10(2)6-11(5-9)14(16-3)12-7-13(15)17-8-12/h7-11,14,16H,4-6H2,1-3H3 |
| InChIKey | GBBCCVCBNYLNCX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.31 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|