C18H20BrN — CID 105052519
1-(2-bromo-5-methylphenyl)-N-methyl-1-(2-phenylcyclopropyl)methanamine (PubChem CID 105052519) has the molecular formula C18H20BrN and a molecular weight of 330.27 g/mol. Its IUPAC name is 1-(2-bromo-5-methylphenyl)-N-methyl-1-(2-phenylcyclopropyl)methanamine.
| Compound Name | 1-(2-bromo-5-methylphenyl)-N-methyl-1-(2-phenylcyclopropyl)methanamine |
|---|---|
| PubChem CID | 105052519 |
| Molecular Formula | C18H20BrN |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 1-(2-bromo-5-methylphenyl)-N-methyl-1-(2-phenylcyclopropyl)methanamine |
| SMILES | CNC(c1cc(C)ccc1Br)C1CC1c1ccccc1 |
| InChI | InChI=1S/C18H20BrN/c1-12-8-9-17(19)16(10-12)18(20-2)15-11-14(15)13-6-4-3-5-7-13/h3-10,14-15,18,20H,11H2,1-2H3 |
| InChIKey | VIZVZQWYQIZTLA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |