C17H16BrClFN — CID 105398891
1-(4-bromo-5-chloro-2-fluorophenyl)-N-methyl-1-(2-phenylcyclopropyl)methanamine (PubChem CID 105398891) has the molecular formula C17H16BrClFN and a molecular weight of 368.68 g/mol. Its IUPAC name is 1-(4-bromo-5-chloro-2-fluorophenyl)-N-methyl-1-(2-phenylcyclopropyl)methanamine.
| Compound Name | 1-(4-bromo-5-chloro-2-fluorophenyl)-N-methyl-1-(2-phenylcyclopropyl)methanamine |
|---|---|
| PubChem CID | 105398891 |
| Molecular Formula | C17H16BrClFN |
| Molecular Weight | 368.68 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | 1-(4-bromo-5-chloro-2-fluorophenyl)-N-methyl-1-(2-phenylcyclopropyl)methanamine |
| SMILES | CNC(c1cc(Cl)c(Br)cc1F)C1CC1c1ccccc1 |
| InChI | InChI=1S/C17H16BrClFN/c1-21-17(13-8-15(19)14(18)9-16(13)20)12-7-11(12)10-5-3-2-4-6-10/h2-6,8-9,11-12,17,21H,7H2,1H3 |
| InChIKey | PRFWYGXEBSNQJH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|