C16H17FN2 — CID 116517836
1-(3-fluoro-4-pyridinyl)-N-methyl-1-(2-phenylcyclopropyl)methanamine (PubChem CID 116517836) has the molecular formula C16H17FN2 and a molecular weight of 256.32 g/mol. Its IUPAC name is 1-(3-fluoro-4-pyridinyl)-N-methyl-1-(2-phenylcyclopropyl)methanamine.
| Compound Name | 1-(3-fluoro-4-pyridinyl)-N-methyl-1-(2-phenylcyclopropyl)methanamine |
|---|---|
| PubChem CID | 116517836 |
| Molecular Formula | C16H17FN2 |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 1-(3-fluoro-4-pyridinyl)-N-methyl-1-(2-phenylcyclopropyl)methanamine |
| SMILES | CNC(c1ccncc1F)C1CC1c1ccccc1 |
| InChI | InChI=1S/C16H17FN2/c1-18-16(12-7-8-19-10-15(12)17)14-9-13(14)11-5-3-2-4-6-11/h2-8,10,13-14,16,18H,9H2,1H3 |
| InChIKey | BZOOQUKUHKXNOE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |