C15H14FNO — CID 116517288
(3-fluoro-4-pyridinyl)-(2-phenylcyclopropyl)methanol (PubChem CID 116517288) has the molecular formula C15H14FNO and a molecular weight of 243.28 g/mol. Its IUPAC name is (3-fluoro-4-pyridinyl)-(2-phenylcyclopropyl)methanol.
| Compound Name | (3-fluoro-4-pyridinyl)-(2-phenylcyclopropyl)methanol |
|---|---|
| PubChem CID | 116517288 |
| Molecular Formula | C15H14FNO |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | (3-fluoro-4-pyridinyl)-(2-phenylcyclopropyl)methanol |
| SMILES | OC(c1ccncc1F)C1CC1c1ccccc1 |
| InChI | InChI=1S/C15H14FNO/c16-14-9-17-7-6-11(14)15(18)13-8-12(13)10-4-2-1-3-5-10/h1-7,9,12-13,15,18H,8H2 |
| InChIKey | LOQMQTLUDFBEMN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |