C14H20FN — CID 116660920
1-(2-fluoro-5-methylphenyl)-N-propylbut-3-en-1-amine (PubChem CID 116660920) has the molecular formula C14H20FN and a molecular weight of 221.32 g/mol. Its IUPAC name is 1-(2-fluoro-5-methylphenyl)-N-propylbut-3-en-1-amine.
| Compound Name | 1-(2-fluoro-5-methylphenyl)-N-propylbut-3-en-1-amine |
|---|---|
| PubChem CID | 116660920 |
| Molecular Formula | C14H20FN |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 1-(2-fluoro-5-methylphenyl)-N-propylbut-3-en-1-amine |
| SMILES | C=CCC(NCCC)c1cc(C)ccc1F |
| InChI | InChI=1S/C14H20FN/c1-4-6-14(16-9-5-2)12-10-11(3)7-8-13(12)15/h4,7-8,10,14,16H,1,5-6,9H2,2-3H3 |
| InChIKey | GWXSEFUNRCQSHQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|