C13H17ClFN — CID 63081783
1-(4-chloro-2-fluorophenyl)-N-propylbut-3-en-1-amine (PubChem CID 63081783) has the molecular formula C13H17ClFN and a molecular weight of 241.74 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-N-propylbut-3-en-1-amine.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-N-propylbut-3-en-1-amine |
|---|---|
| PubChem CID | 63081783 |
| Molecular Formula | C13H17ClFN |
| Molecular Weight | 241.74 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-N-propylbut-3-en-1-amine |
| SMILES | C=CCC(NCCC)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C13H17ClFN/c1-3-5-13(16-8-4-2)11-7-6-10(14)9-12(11)15/h3,6-7,9,13,16H,1,4-5,8H2,2H3 |
| InChIKey | ZCEGGRZWNCLYOI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.74 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|