C14H22N4OS — CID 116664985
4-amino-N-(cyclohex-3-en-1-ylmethyl)-2-(propan-2-ylamino)-1,3-thiazole-5-carboxamide (PubChem CID 116664985) has the molecular formula C14H22N4OS and a molecular weight of 294.42 g/mol. Its IUPAC name is 4-amino-N-(cyclohex-3-en-1-ylmethyl)-2-(propan-2-ylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N-(cyclohex-3-en-1-ylmethyl)-2-(propan-2-ylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116664985 |
| Molecular Formula | C14H22N4OS |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 4-amino-N-(cyclohex-3-en-1-ylmethyl)-2-(propan-2-ylamino)-1,3-thiazole-5-carboxamide |
| SMILES | CC(C)Nc1nc(N)c(C(=O)NCC2CC=CCC2)s1 |
| InChI | InChI=1S/C14H22N4OS/c1-9(2)17-14-18-12(15)11(20-14)13(19)16-8-10-6-4-3-5-7-10/h3-4,9-10H,5-8,15H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | LYAHHLZEHWSCGW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|