About [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(2,4-dimethylpiperidin-1-yl)methanone
[4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(2,4-dimethylpiperidin-1-yl)methanone (PubChem CID 116665334) has the molecular formula C14H22N4OS
and a molecular weight of 294.42 g/mol. Its IUPAC name is [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(2,4-dimethylpiperidin-1-yl)methanone.
Molecular Properties
| Compound Name | [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(2,4-dimethylpiperidin-1-yl)methanone |
| PubChem CID | 116665334 |
| Molecular Formula | C14H22N4OS |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(2,4-dimethylpiperidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)c2sc(NC3CC3)nc2N)C(C)C1 |
| InChI | InChI=1S/C14H22N4OS/c1-8-5-6-18(9(2)7-8)13(19)11-12(15)17-14(20-11)16-10-3-4-10/h8-10H,3-7,15H2,1-2H3,(H,16,17) |
| InChIKey | CCSNEMJXIKCNIU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(2,4-dimethylpiperidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(2,4-dimethylpiperidin-1-yl)methanone?
The IUPAC name of [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(2,4-dimethylpiperidin-1-yl)methanone (CID 116665334) is [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(2,4-dimethylpiperidin-1-yl)methanone.
What is the SMILES notation for [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(2,4-dimethylpiperidin-1-yl)methanone?
The canonical SMILES for [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(2,4-dimethylpiperidin-1-yl)methanone is CC1CCN(C(=O)c2sc(NC3CC3)nc2N)C(C)C1.
What is the InChIKey of [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(2,4-dimethylpiperidin-1-yl)methanone?
The InChIKey is CCSNEMJXIKCNIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4OS/c1-8-5-6-18(9(2)7-8)13(19)11-12(15)17-14(20-11)16-10-3-4-10/h8-10H,3-7,15H2,1-2H3,(H,16,17).
What are the key properties of [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(2,4-dimethylpiperidin-1-yl)methanone?
[4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(2,4-dimethylpiperidin-1-yl)methanone has a molecular weight of 294.42 g/mol, XLogP of 2.56, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-amino-2-(cyclopropylamino)-1,3-thiazol-5-yl]-(2,4-dimethylpiperidin-1-yl)methanone is sourced from PubChem (CID 116665334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).