C13H18N4OS — CID 116671896
4-amino-N-ethyl-N-prop-2-ynyl-2-pyrrolidin-1-yl-1,3-thiazole-5-carboxamide (PubChem CID 116671896) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is 4-amino-N-ethyl-N-prop-2-ynyl-2-pyrrolidin-1-yl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N-ethyl-N-prop-2-ynyl-2-pyrrolidin-1-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116671896 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 4-amino-N-ethyl-N-prop-2-ynyl-2-pyrrolidin-1-yl-1,3-thiazole-5-carboxamide |
| SMILES | C#CCN(CC)C(=O)c1sc(N2CCCC2)nc1N |
| InChI | InChI=1S/C13H18N4OS/c1-3-7-16(4-2)12(18)10-11(14)15-13(19-10)17-8-5-6-9-17/h1H,4-9,14H2,2H3 |
| InChIKey | YYCWEXKHQMKDJJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|