C12H18N6OS — CID 116672549
4-amino-2-(ethylamino)-N-(3-pyrazol-1-ylpropyl)-1,3-thiazole-5-carboxamide (PubChem CID 116672549) has the molecular formula C12H18N6OS and a molecular weight of 294.38 g/mol. Its IUPAC name is 4-amino-2-(ethylamino)-N-(3-pyrazol-1-ylpropyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-(ethylamino)-N-(3-pyrazol-1-ylpropyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116672549 |
| Molecular Formula | C12H18N6OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 4-amino-2-(ethylamino)-N-(3-pyrazol-1-ylpropyl)-1,3-thiazole-5-carboxamide |
| SMILES | CCNc1nc(N)c(C(=O)NCCCn2cccn2)s1 |
| InChI | InChI=1S/C12H18N6OS/c1-2-14-12-17-10(13)9(20-12)11(19)15-5-3-7-18-8-4-6-16-18/h4,6,8H,2-3,5,7,13H2,1H3,(H,14,17)(H,15,19) |
| InChIKey | IAJPLLOGAUKLFY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|