C13H21N5OS — CID 116672879
4-amino-2-(3-aminopiperidin-1-yl)-N-but-3-en-2-yl-1,3-thiazole-5-carboxamide (PubChem CID 116672879) has the molecular formula C13H21N5OS and a molecular weight of 295.41 g/mol. Its IUPAC name is 4-amino-2-(3-aminopiperidin-1-yl)-N-but-3-en-2-yl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-(3-aminopiperidin-1-yl)-N-but-3-en-2-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116672879 |
| Molecular Formula | C13H21N5OS |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 4-amino-2-(3-aminopiperidin-1-yl)-N-but-3-en-2-yl-1,3-thiazole-5-carboxamide |
| SMILES | C=CC(C)NC(=O)c1sc(N2CCCC(N)C2)nc1N |
| InChI | InChI=1S/C13H21N5OS/c1-3-8(2)16-12(19)10-11(15)17-13(20-10)18-6-4-5-9(14)7-18/h3,8-9H,1,4-7,14-15H2,2H3,(H,16,19) |
| InChIKey | VHVXQTHETHALMI-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|