C12H22N4O2S2 — CID 116672922
4-amino-2-(diethylamino)-N-(3-methylsulfinylpropyl)-1,3-thiazole-5-carboxamide (PubChem CID 116672922) has the molecular formula C12H22N4O2S2 and a molecular weight of 318.47 g/mol. Its IUPAC name is 4-amino-2-(diethylamino)-N-(3-methylsulfinylpropyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-(diethylamino)-N-(3-methylsulfinylpropyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116672922 |
| Molecular Formula | C12H22N4O2S2 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 4-amino-2-(diethylamino)-N-(3-methylsulfinylpropyl)-1,3-thiazole-5-carboxamide |
| SMILES | CCN(CC)c1nc(N)c(C(=O)NCCCS(C)=O)s1 |
| InChI | InChI=1S/C12H22N4O2S2/c1-4-16(5-2)12-15-10(13)9(19-12)11(17)14-7-6-8-20(3)18/h4-8,13H2,1-3H3,(H,14,17) |
| InChIKey | VUDBQZPAHDFMGK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|