C22H32O3 — CID 11667345
(2S,3R,3aS,4R,6S,6aS)-2-hexyl-4,6-bis(hydroxymethyl)-3-phenyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one (PubChem CID 11667345) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (2S,3R,3aS,4R,6S,6aS)-2-hexyl-4,6-bis(hydroxymethyl)-3-phenyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one.
| Compound Name | (2S,3R,3aS,4R,6S,6aS)-2-hexyl-4,6-bis(hydroxymethyl)-3-phenyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one |
|---|---|
| PubChem CID | 11667345 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (2S,3R,3aS,4R,6S,6aS)-2-hexyl-4,6-bis(hydroxymethyl)-3-phenyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-one |
| SMILES | CCCCCC[C@@H]1C(=O)[C@@H]2[C@@H](CO)C[C@@H](CO)[C@@H]2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H32O3/c1-2-3-4-8-11-18-19(15-9-6-5-7-10-15)20-16(13-23)12-17(14-24)21(20)22(18)25/h5-7,9-10,16-21,23-24H,2-4,8,11-14H2,1H3/t16-,17+,18-,19-,20+,21+/m0/s1 |
| InChIKey | PEWPHCYEOSAWBP-NXMWLWCLSA-N |
| XLogP | 3.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|