C10H17N3O2S — CID 116674050
propyl 4-amino-2-(propylamino)-1,3-thiazole-5-carboxylate (PubChem CID 116674050) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is propyl 4-amino-2-(propylamino)-1,3-thiazole-5-carboxylate.
| Compound Name | propyl 4-amino-2-(propylamino)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 116674050 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | propyl 4-amino-2-(propylamino)-1,3-thiazole-5-carboxylate |
| SMILES | CCCNc1nc(N)c(C(=O)OCCC)s1 |
| InChI | InChI=1S/C10H17N3O2S/c1-3-5-12-10-13-8(11)7(16-10)9(14)15-6-4-2/h3-6,11H2,1-2H3,(H,12,13) |
| InChIKey | KPPVJEJTKUACPL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |