C10H16N4OS — CID 116674069
4-amino-N-prop-2-enyl-2-(propylamino)-1,3-thiazole-5-carboxamide (PubChem CID 116674069) has the molecular formula C10H16N4OS and a molecular weight of 240.33 g/mol. Its IUPAC name is 4-amino-N-prop-2-enyl-2-(propylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N-prop-2-enyl-2-(propylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116674069 |
| Molecular Formula | C10H16N4OS |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4-amino-N-prop-2-enyl-2-(propylamino)-1,3-thiazole-5-carboxamide |
| SMILES | C=CCNC(=O)c1sc(NCCC)nc1N |
| InChI | InChI=1S/C10H16N4OS/c1-3-5-12-9(15)7-8(11)14-10(16-7)13-6-4-2/h3H,1,4-6,11H2,2H3,(H,12,15)(H,13,14) |
| InChIKey | VXUFXFQNNBACKQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|