C16H18N2O3 — CID 116678587
1-[2-(azetidin-3-ylidene)propanoyl]-3,4-dihydro-2H-quinoline-4-carboxylic acid (PubChem CID 116678587) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 1-[2-(azetidin-3-ylidene)propanoyl]-3,4-dihydro-2H-quinoline-4-carboxylic acid.
| Compound Name | 1-[2-(azetidin-3-ylidene)propanoyl]-3,4-dihydro-2H-quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 116678587 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 1-[2-(azetidin-3-ylidene)propanoyl]-3,4-dihydro-2H-quinoline-4-carboxylic acid |
| SMILES | CC(C(=O)N1CCC(C(=O)O)c2ccccc21)=C1CNC1 |
| InChI | InChI=1S/C16H18N2O3/c1-10(11-8-17-9-11)15(19)18-7-6-13(16(20)21)12-4-2-3-5-14(12)18/h2-5,13,17H,6-9H2,1H3,(H,20,21) |
| InChIKey | HUPHKAHWGKHOBK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|