3-[2-(azetidin-3-yl)propanoylamino]-5,5-dimethylhexanoic acid

C14H26N2O3 — CID 116679069

IUPAC3-[2-(azetidin-3-yl)propanoylamino]-5,5-dimethylhexanoic acid
SMILESCC(C(=O)NC(CC(=O)O)CC(C)(C)C)C1CNC1
InChIInChI=1S/C14H26N2O3/c1-9(10-7-15-8-10)13(19)16-11(5-12(17)18)6-14(2,3)4/h9-11,15H,5-8H2,1-4H3,(H,16,19)(H,17,18)
InChIKeyWNZNSZNYKRXDEJ-UHFFFAOYSA-N
MW270.37 g/mol
LogP1.24
Rot. Bonds6

About 3-[2-(azetidin-3-yl)propanoylamino]-5,5-dimethylhexanoic acid

3-[2-(azetidin-3-yl)propanoylamino]-5,5-dimethylhexanoic acid (PubChem CID 116679069) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is 3-[2-(azetidin-3-yl)propanoylamino]-5,5-dimethylhexanoic acid.

Molecular Properties

Compound Name3-[2-(azetidin-3-yl)propanoylamino]-5,5-dimethylhexanoic acid
PubChem CID116679069
Molecular FormulaC14H26N2O3
Molecular Weight270.37 g/mol
Exact Mass270.19
IUPAC Name3-[2-(azetidin-3-yl)propanoylamino]-5,5-dimethylhexanoic acid
SMILESCC(C(=O)NC(CC(=O)O)CC(C)(C)C)C1CNC1
InChIInChI=1S/C14H26N2O3/c1-9(10-7-15-8-10)13(19)16-11(5-12(17)18)6-14(2,3)4/h9-11,15H,5-8H2,1-4H3,(H,16,19)(H,17,18)
InChIKeyWNZNSZNYKRXDEJ-UHFFFAOYSA-N
XLogP1.24
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.37
LogP ≤ 51.24
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 3-[2-(azetidin-3-yl)propanoylamino]-5,5-dimethylhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(azetidin-3-yl)propanoylamino]-5,5-dimethylhexanoic acid?
The IUPAC name of 3-[2-(azetidin-3-yl)propanoylamino]-5,5-dimethylhexanoic acid (CID 116679069) is 3-[2-(azetidin-3-yl)propanoylamino]-5,5-dimethylhexanoic acid.
What is the SMILES notation for 3-[2-(azetidin-3-yl)propanoylamino]-5,5-dimethylhexanoic acid?
The canonical SMILES for 3-[2-(azetidin-3-yl)propanoylamino]-5,5-dimethylhexanoic acid is CC(C(=O)NC(CC(=O)O)CC(C)(C)C)C1CNC1.
What is the InChIKey of 3-[2-(azetidin-3-yl)propanoylamino]-5,5-dimethylhexanoic acid?
The InChIKey is WNZNSZNYKRXDEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O3/c1-9(10-7-15-8-10)13(19)16-11(5-12(17)18)6-14(2,3)4/h9-11,15H,5-8H2,1-4H3,(H,16,19)(H,17,18).
What are the key properties of 3-[2-(azetidin-3-yl)propanoylamino]-5,5-dimethylhexanoic acid?
3-[2-(azetidin-3-yl)propanoylamino]-5,5-dimethylhexanoic acid has a molecular weight of 270.37 g/mol, XLogP of 1.24, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(azetidin-3-yl)propanoylamino]-5,5-dimethylhexanoic acid is sourced from PubChem (CID 116679069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).