C9H14F2N2O — CID 116679092
2-(azetidin-3-ylidene)-N-(2,2-difluoroethyl)-N-methylpropanamide (PubChem CID 116679092) has the molecular formula C9H14F2N2O and a molecular weight of 204.22 g/mol. Its IUPAC name is 2-(azetidin-3-ylidene)-N-(2,2-difluoroethyl)-N-methylpropanamide.
| Compound Name | 2-(azetidin-3-ylidene)-N-(2,2-difluoroethyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 116679092 |
| Molecular Formula | C9H14F2N2O |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 2-(azetidin-3-ylidene)-N-(2,2-difluoroethyl)-N-methylpropanamide |
| SMILES | CC(C(=O)N(C)CC(F)F)=C1CNC1 |
| InChI | InChI=1S/C9H14F2N2O/c1-6(7-3-12-4-7)9(14)13(2)5-8(10)11/h8,12H,3-5H2,1-2H3 |
| InChIKey | BLKYOHGUNIDERF-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|