C8H12F2N2O — CID 172623955
2-[(3,3-difluoroazetidin-1-yl)methyl]-N-methylprop-2-enamide (PubChem CID 172623955) has the molecular formula C8H12F2N2O and a molecular weight of 190.19 g/mol. Its IUPAC name is 2-[(3,3-difluoroazetidin-1-yl)methyl]-N-methylprop-2-enamide.
| Compound Name | 2-[(3,3-difluoroazetidin-1-yl)methyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 172623955 |
| Molecular Formula | C8H12F2N2O |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 2-[(3,3-difluoroazetidin-1-yl)methyl]-N-methylprop-2-enamide |
| SMILES | C=C(CN1CC(F)(F)C1)C(=O)NC |
| InChI | InChI=1S/C8H12F2N2O/c1-6(7(13)11-2)3-12-4-8(9,10)5-12/h1,3-5H2,2H3,(H,11,13) |
| InChIKey | NHMLWDJNXOHDHQ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|